C15H12F3NO2 — CID 65100671
2,4,6-trifluoro-N-[4-(1-hydroxyethyl)phenyl]benzamide (PubChem CID 65100671) has the molecular formula C15H12F3NO2 and a molecular weight of 295.26 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-[4-(1-hydroxyethyl)phenyl]benzamide.
| Compound Name | 2,4,6-trifluoro-N-[4-(1-hydroxyethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 65100671 |
| Molecular Formula | C15H12F3NO2 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2,4,6-trifluoro-N-[4-(1-hydroxyethyl)phenyl]benzamide |
| SMILES | CC(O)c1ccc(NC(=O)c2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C15H12F3NO2/c1-8(20)9-2-4-11(5-3-9)19-15(21)14-12(17)6-10(16)7-13(14)18/h2-8,20H,1H3,(H,19,21) |
| InChIKey | RZXOQCHWSYAPRZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |