C13H7Cl3FNO2 — CID 107015128
4-fluoro-2-hydroxy-N-(2,4,6-trichlorophenyl)benzamide (PubChem CID 107015128) has the molecular formula C13H7Cl3FNO2 and a molecular weight of 334.56 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-(2,4,6-trichlorophenyl)benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-(2,4,6-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 107015128 |
| Molecular Formula | C13H7Cl3FNO2 |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-(2,4,6-trichlorophenyl)benzamide |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1Cl)c1ccc(F)cc1O |
| InChI | InChI=1S/C13H7Cl3FNO2/c14-6-3-9(15)12(10(16)4-6)18-13(20)8-2-1-7(17)5-11(8)19/h1-5,19H,(H,18,20) |
| InChIKey | GATLXESWOLUTFL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |