C13H9Br2FN2O2 — CID 107013162
N-(4-amino-2,6-dibromophenyl)-4-fluoro-2-hydroxybenzamide (PubChem CID 107013162) has the molecular formula C13H9Br2FN2O2 and a molecular weight of 404.03 g/mol. Its IUPAC name is N-(4-amino-2,6-dibromophenyl)-4-fluoro-2-hydroxybenzamide.
| Compound Name | N-(4-amino-2,6-dibromophenyl)-4-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 107013162 |
| Molecular Formula | C13H9Br2FN2O2 |
| Molecular Weight | 404.03 g/mol |
| Exact Mass | 401.90 |
| IUPAC Name | N-(4-amino-2,6-dibromophenyl)-4-fluoro-2-hydroxybenzamide |
| SMILES | Nc1cc(Br)c(NC(=O)c2ccc(F)cc2O)c(Br)c1 |
| InChI | InChI=1S/C13H9Br2FN2O2/c14-9-4-7(17)5-10(15)12(9)18-13(20)8-2-1-6(16)3-11(8)19/h1-5,19H,17H2,(H,18,20) |
| InChIKey | HZVOHJMISFVDKI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.03 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|