C13H7Cl2F2NO2 — CID 83078997
N-(2,6-dichloro-4-fluorophenyl)-5-fluoro-2-hydroxybenzamide (PubChem CID 83078997) has the molecular formula C13H7Cl2F2NO2 and a molecular weight of 318.11 g/mol. Its IUPAC name is N-(2,6-dichloro-4-fluorophenyl)-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-(2,6-dichloro-4-fluorophenyl)-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 83078997 |
| Molecular Formula | C13H7Cl2F2NO2 |
| Molecular Weight | 318.11 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | N-(2,6-dichloro-4-fluorophenyl)-5-fluoro-2-hydroxybenzamide |
| SMILES | O=C(Nc1c(Cl)cc(F)cc1Cl)c1cc(F)ccc1O |
| InChI | InChI=1S/C13H7Cl2F2NO2/c14-9-4-7(17)5-10(15)12(9)18-13(20)8-3-6(16)1-2-11(8)19/h1-5,19H,(H,18,20) |
| InChIKey | LOLHDWNFIBSGAK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.11 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |