C16H14FN5O3S — CID 2348802
5-[(4-fluorophenyl)sulfamoyl]-2-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 2348802) has the molecular formula C16H14FN5O3S and a molecular weight of 375.39 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)sulfamoyl]-2-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 5-[(4-fluorophenyl)sulfamoyl]-2-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 2348802 |
| Molecular Formula | C16H14FN5O3S |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 5-[(4-fluorophenyl)sulfamoyl]-2-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1C(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C16H14FN5O3S/c1-10-2-7-13(8-14(10)15(23)20-16-18-9-19-21-16)26(24,25)22-12-5-3-11(17)4-6-12/h2-9,22H,1H3,(H2,18,19,20,21,23) |
| InChIKey | IWWFJYDXLKWPRA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |