C24H20FN3O3S — CID 38266314
5-[(4-fluorophenyl)sulfamoyl]-2-methyl-N-(8-methylquinolin-5-yl)benzamide (PubChem CID 38266314) has the molecular formula C24H20FN3O3S and a molecular weight of 449.51 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)sulfamoyl]-2-methyl-N-(8-methylquinolin-5-yl)benzamide.
| Compound Name | 5-[(4-fluorophenyl)sulfamoyl]-2-methyl-N-(8-methylquinolin-5-yl)benzamide |
|---|---|
| PubChem CID | 38266314 |
| Molecular Formula | C24H20FN3O3S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 5-[(4-fluorophenyl)sulfamoyl]-2-methyl-N-(8-methylquinolin-5-yl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1C(=O)Nc1ccc(C)c2ncccc12 |
| InChI | InChI=1S/C24H20FN3O3S/c1-15-5-11-19(32(30,31)28-18-9-7-17(25)8-10-18)14-21(15)24(29)27-22-12-6-16(2)23-20(22)4-3-13-26-23/h3-14,28H,1-2H3,(H,27,29) |
| InChIKey | XDAQDNMVGDMLNA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |