C10H9FN4O4S — CID 81434979
2-fluoro-3-methyl-5-(1H-1,2,4-triazol-5-ylsulfamoyl)benzoic acid (PubChem CID 81434979) has the molecular formula C10H9FN4O4S and a molecular weight of 300.27 g/mol. Its IUPAC name is 2-fluoro-3-methyl-5-(1H-1,2,4-triazol-5-ylsulfamoyl)benzoic acid.
| Compound Name | 2-fluoro-3-methyl-5-(1H-1,2,4-triazol-5-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 81434979 |
| Molecular Formula | C10H9FN4O4S |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-fluoro-3-methyl-5-(1H-1,2,4-triazol-5-ylsulfamoyl)benzoic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2ncn[nH]2)cc(C(=O)O)c1F |
| InChI | InChI=1S/C10H9FN4O4S/c1-5-2-6(3-7(8(5)11)9(16)17)20(18,19)15-10-12-4-13-14-10/h2-4H,1H3,(H,16,17)(H2,12,13,14,15) |
| InChIKey | OMYQUWITHLTGBL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |