C13H15FN2O4S — CID 81426683
5-(4-cyanobutylsulfamoyl)-2-fluoro-3-methylbenzoic acid (PubChem CID 81426683) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is 5-(4-cyanobutylsulfamoyl)-2-fluoro-3-methylbenzoic acid.
| Compound Name | 5-(4-cyanobutylsulfamoyl)-2-fluoro-3-methylbenzoic acid |
|---|---|
| PubChem CID | 81426683 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 5-(4-cyanobutylsulfamoyl)-2-fluoro-3-methylbenzoic acid |
| SMILES | Cc1cc(S(=O)(=O)NCCCCC#N)cc(C(=O)O)c1F |
| InChI | InChI=1S/C13H15FN2O4S/c1-9-7-10(8-11(12(9)14)13(17)18)21(19,20)16-6-4-2-3-5-15/h7-8,16H,2-4,6H2,1H3,(H,17,18) |
| InChIKey | CSBWXKOYWYSUQS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|