C10H7Cl2N3O2 — CID 114917035
2,5-dichloro-N-(5-methyl-1,2-oxazol-3-yl)pyridine-4-carboxamide (PubChem CID 114917035) has the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.09 g/mol. Its IUPAC name is 2,5-dichloro-N-(5-methyl-1,2-oxazol-3-yl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(5-methyl-1,2-oxazol-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114917035 |
| Molecular Formula | C10H7Cl2N3O2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 2,5-dichloro-N-(5-methyl-1,2-oxazol-3-yl)pyridine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc(Cl)ncc2Cl)no1 |
| InChI | InChI=1S/C10H7Cl2N3O2/c1-5-2-9(15-17-5)14-10(16)6-3-8(12)13-4-7(6)11/h2-4H,1H3,(H,14,15,16) |
| InChIKey | DRDKRWQQLNPTOW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|