C13H9Cl2FN2O — CID 114917077
2,5-dichloro-N-(4-fluoro-2-methylphenyl)pyridine-4-carboxamide (PubChem CID 114917077) has the molecular formula C13H9Cl2FN2O and a molecular weight of 299.13 g/mol. Its IUPAC name is 2,5-dichloro-N-(4-fluoro-2-methylphenyl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(4-fluoro-2-methylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114917077 |
| Molecular Formula | C13H9Cl2FN2O |
| Molecular Weight | 299.13 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2,5-dichloro-N-(4-fluoro-2-methylphenyl)pyridine-4-carboxamide |
| SMILES | Cc1cc(F)ccc1NC(=O)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C13H9Cl2FN2O/c1-7-4-8(16)2-3-11(7)18-13(19)9-5-12(15)17-6-10(9)14/h2-6H,1H3,(H,18,19) |
| InChIKey | LBHVTRIQQIDMGX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.13 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|