C13H8ClF4N3O — CID 2780354
2-chloro-N-(4-fluoro-2-methylphenyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 2780354) has the molecular formula C13H8ClF4N3O and a molecular weight of 333.67 g/mol. Its IUPAC name is 2-chloro-N-(4-fluoro-2-methylphenyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-chloro-N-(4-fluoro-2-methylphenyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 2780354 |
| Molecular Formula | C13H8ClF4N3O |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-chloro-N-(4-fluoro-2-methylphenyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | Cc1cc(F)ccc1NC(=O)c1cnc(Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C13H8ClF4N3O/c1-6-4-7(15)2-3-9(6)20-11(22)8-5-19-12(14)21-10(8)13(16,17)18/h2-5H,1H3,(H,20,22) |
| InChIKey | HOUVROVIYDHMMD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |