C14H12Cl2FN3O — CID 114922085
5-chloro-N-(2-chloro-4-fluorophenyl)-2-(ethylamino)pyridine-4-carboxamide (PubChem CID 114922085) has the molecular formula C14H12Cl2FN3O and a molecular weight of 328.17 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-4-fluorophenyl)-2-(ethylamino)pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-(2-chloro-4-fluorophenyl)-2-(ethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114922085 |
| Molecular Formula | C14H12Cl2FN3O |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 5-chloro-N-(2-chloro-4-fluorophenyl)-2-(ethylamino)pyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)Nc2ccc(F)cc2Cl)c(Cl)cn1 |
| InChI | InChI=1S/C14H12Cl2FN3O/c1-2-18-13-6-9(11(16)7-19-13)14(21)20-12-4-3-8(17)5-10(12)15/h3-7H,2H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | KLIQRWSKZSMGLP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |