C13H9Cl2FN2O2 — CID 114918264
2,5-dichloro-N-(4-fluoro-2-methoxyphenyl)pyridine-4-carboxamide (PubChem CID 114918264) has the molecular formula C13H9Cl2FN2O2 and a molecular weight of 315.13 g/mol. Its IUPAC name is 2,5-dichloro-N-(4-fluoro-2-methoxyphenyl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(4-fluoro-2-methoxyphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114918264 |
| Molecular Formula | C13H9Cl2FN2O2 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 2,5-dichloro-N-(4-fluoro-2-methoxyphenyl)pyridine-4-carboxamide |
| SMILES | COc1cc(F)ccc1NC(=O)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C13H9Cl2FN2O2/c1-20-11-4-7(16)2-3-10(11)18-13(19)8-5-12(15)17-6-9(8)14/h2-6H,1H3,(H,18,19) |
| InChIKey | IWSKLXGNXKCRIL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|