C12H12FN5O2 — CID 107377845
N-(4-fluoro-2-methoxyphenyl)-5-hydrazinylpyrazine-2-carboxamide (PubChem CID 107377845) has the molecular formula C12H12FN5O2 and a molecular weight of 277.26 g/mol. Its IUPAC name is N-(4-fluoro-2-methoxyphenyl)-5-hydrazinylpyrazine-2-carboxamide.
| Compound Name | N-(4-fluoro-2-methoxyphenyl)-5-hydrazinylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107377845 |
| Molecular Formula | C12H12FN5O2 |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-(4-fluoro-2-methoxyphenyl)-5-hydrazinylpyrazine-2-carboxamide |
| SMILES | COc1cc(F)ccc1NC(=O)c1cnc(NN)cn1 |
| InChI | InChI=1S/C12H12FN5O2/c1-20-10-4-7(13)2-3-8(10)17-12(19)9-5-16-11(18-14)6-15-9/h2-6H,14H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | KSGTWGLEUPHRIA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|