C12H9Cl2N3O2 — CID 114917038
2,5-dichloro-N-(6-methoxy-3-pyridinyl)pyridine-4-carboxamide (PubChem CID 114917038) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is 2,5-dichloro-N-(6-methoxy-3-pyridinyl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(6-methoxy-3-pyridinyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114917038 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2,5-dichloro-N-(6-methoxy-3-pyridinyl)pyridine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(Cl)ncc2Cl)cn1 |
| InChI | InChI=1S/C12H9Cl2N3O2/c1-19-11-3-2-7(5-16-11)17-12(18)8-4-10(14)15-6-9(8)13/h2-6H,1H3,(H,17,18) |
| InChIKey | AOMHAVXRTKBOPK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|