C9H7Cl3N2O2 — CID 3780869
2,3,3-trichloro-N-(6-methoxy-3-pyridinyl)prop-2-enamide (PubChem CID 3780869) has the molecular formula C9H7Cl3N2O2 and a molecular weight of 281.53 g/mol. Its IUPAC name is 2,3,3-trichloro-N-(6-methoxy-3-pyridinyl)prop-2-enamide.
| Compound Name | 2,3,3-trichloro-N-(6-methoxy-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 3780869 |
| Molecular Formula | C9H7Cl3N2O2 |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 2,3,3-trichloro-N-(6-methoxy-3-pyridinyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C(Cl)=C(Cl)Cl)cn1 |
| InChI | InChI=1S/C9H7Cl3N2O2/c1-16-6-3-2-5(4-13-6)14-9(15)7(10)8(11)12/h2-4H,1H3,(H,14,15) |
| InChIKey | ARRYTWLDUDIQJR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|