C9H13N3O3 — CID 47237458
1-(2-hydroxyethyl)-3-(6-methoxy-3-pyridinyl)urea (PubChem CID 47237458) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(6-methoxy-3-pyridinyl)urea.
| Compound Name | 1-(2-hydroxyethyl)-3-(6-methoxy-3-pyridinyl)urea |
|---|---|
| PubChem CID | 47237458 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(6-methoxy-3-pyridinyl)urea |
| SMILES | COc1ccc(NC(=O)NCCO)cn1 |
| InChI | InChI=1S/C9H13N3O3/c1-15-8-3-2-7(6-11-8)12-9(14)10-4-5-13/h2-3,6,13H,4-5H2,1H3,(H2,10,12,14) |
| InChIKey | VEDSXUQLTZVQMU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |