C13H12N4O3 — CID 154047378
2-N-(6-methoxy-3-pyridinyl)pyridine-2,5-dicarboxamide (PubChem CID 154047378) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2-N-(6-methoxy-3-pyridinyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(6-methoxy-3-pyridinyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 154047378 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-N-(6-methoxy-3-pyridinyl)pyridine-2,5-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(C(N)=O)cn2)cn1 |
| InChI | InChI=1S/C13H12N4O3/c1-20-11-5-3-9(7-16-11)17-13(19)10-4-2-8(6-15-10)12(14)18/h2-7H,1H3,(H2,14,18)(H,17,19) |
| InChIKey | JZMPSANRHDXJFA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |