C13H8BrCl3N2O — CID 114918857
N-(2-bromo-5-chloro-4-methylphenyl)-2,5-dichloropyridine-4-carboxamide (PubChem CID 114918857) has the molecular formula C13H8BrCl3N2O and a molecular weight of 394.48 g/mol. Its IUPAC name is N-(2-bromo-5-chloro-4-methylphenyl)-2,5-dichloropyridine-4-carboxamide.
| Compound Name | N-(2-bromo-5-chloro-4-methylphenyl)-2,5-dichloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 114918857 |
| Molecular Formula | C13H8BrCl3N2O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 391.89 |
| IUPAC Name | N-(2-bromo-5-chloro-4-methylphenyl)-2,5-dichloropyridine-4-carboxamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2cc(Cl)ncc2Cl)cc1Cl |
| InChI | InChI=1S/C13H8BrCl3N2O/c1-6-2-8(14)11(4-9(6)15)19-13(20)7-3-12(17)18-5-10(7)16/h2-5H,1H3,(H,19,20) |
| InChIKey | NPNRIAQQZRJIKS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|