C11H9BrClN3O — CID 104724206
N-(2-bromo-5-chloro-4-methylphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 104724206) has the molecular formula C11H9BrClN3O and a molecular weight of 314.57 g/mol. Its IUPAC name is N-(2-bromo-5-chloro-4-methylphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2-bromo-5-chloro-4-methylphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 104724206 |
| Molecular Formula | C11H9BrClN3O |
| Molecular Weight | 314.57 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | N-(2-bromo-5-chloro-4-methylphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2cn[nH]c2)cc1Cl |
| InChI | InChI=1S/C11H9BrClN3O/c1-6-2-8(12)10(3-9(6)13)16-11(17)7-4-14-15-5-7/h2-5H,1H3,(H,14,15)(H,16,17) |
| InChIKey | ZXUUZGBEAKKKTE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |