C17H12N6O — CID 30865963
2-pyridin-4-yl-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide (PubChem CID 30865963) has the molecular formula C17H12N6O and a molecular weight of 316.32 g/mol. Its IUPAC name is 2-pyridin-4-yl-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide.
| Compound Name | 2-pyridin-4-yl-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 30865963 |
| Molecular Formula | C17H12N6O |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-pyridin-4-yl-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1ncn[nH]1)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C17H12N6O/c24-16(22-17-19-10-20-23-17)13-9-15(11-5-7-18-8-6-11)21-14-4-2-1-3-12(13)14/h1-10H,(H2,19,20,22,23,24) |
| InChIKey | GNMWSHHETGAVFT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |