C19H16N6OS — CID 72852185
2-pyridin-4-yl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]quinoline-4-carboxamide (PubChem CID 72852185) has the molecular formula C19H16N6OS and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-pyridin-4-yl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]quinoline-4-carboxamide.
| Compound Name | 2-pyridin-4-yl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 72852185 |
| Molecular Formula | C19H16N6OS |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-pyridin-4-yl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]quinoline-4-carboxamide |
| SMILES | O=C(NCCSc1ncn[nH]1)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C19H16N6OS/c26-18(21-9-10-27-19-22-12-23-25-19)15-11-17(13-5-7-20-8-6-13)24-16-4-2-1-3-14(15)16/h1-8,11-12H,9-10H2,(H,21,26)(H,22,23,25) |
| InChIKey | UGSHIYQFVQKVRM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|