C19H15N5O — CID 30865928
2-(4-methylphenyl)-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide (PubChem CID 30865928) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide.
| Compound Name | 2-(4-methylphenyl)-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 30865928 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-(4-methylphenyl)-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3ncn[nH]3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C19H15N5O/c1-12-6-8-13(9-7-12)17-10-15(14-4-2-3-5-16(14)22-17)18(25)23-19-20-11-21-24-19/h2-11H,1H3,(H2,20,21,23,24,25) |
| InChIKey | YAYPMMIOHFZERW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |