C16H11N5OS — CID 30865965
2-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide (PubChem CID 30865965) has the molecular formula C16H11N5OS and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide.
| Compound Name | 2-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 30865965 |
| Molecular Formula | C16H11N5OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1ncn[nH]1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C16H11N5OS/c22-15(20-16-17-9-18-21-16)11-8-13(14-6-3-7-23-14)19-12-5-2-1-4-10(11)12/h1-9H,(H2,17,18,20,21,22) |
| InChIKey | VBJDGBZXMDYDHP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |