C17H13N3O3S — CID 39194623
3-[(2-amino-4-phenyl-1,3-thiazole-5-carbonyl)amino]benzoic acid (PubChem CID 39194623) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 3-[(2-amino-4-phenyl-1,3-thiazole-5-carbonyl)amino]benzoic acid.
| Compound Name | 3-[(2-amino-4-phenyl-1,3-thiazole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 39194623 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-[(2-amino-4-phenyl-1,3-thiazole-5-carbonyl)amino]benzoic acid |
| SMILES | Nc1nc(-c2ccccc2)c(C(=O)Nc2cccc(C(=O)O)c2)s1 |
| InChI | InChI=1S/C17H13N3O3S/c18-17-20-13(10-5-2-1-3-6-10)14(24-17)15(21)19-12-8-4-7-11(9-12)16(22)23/h1-9H,(H2,18,20)(H,19,21)(H,22,23) |
| InChIKey | YQZWZCLMUMUNON-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |