C10H9N3OS2 — CID 151260431
2-amino-N-phenyl-4-sulfanyl-1,3-thiazole-5-carboxamide (PubChem CID 151260431) has the molecular formula C10H9N3OS2 and a molecular weight of 251.34 g/mol. Its IUPAC name is 2-amino-N-phenyl-4-sulfanyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-phenyl-4-sulfanyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 151260431 |
| Molecular Formula | C10H9N3OS2 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 2-amino-N-phenyl-4-sulfanyl-1,3-thiazole-5-carboxamide |
| SMILES | Nc1nc(S)c(C(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C10H9N3OS2/c11-10-13-9(15)7(16-10)8(14)12-6-4-2-1-3-5-6/h1-5,15H,(H2,11,13)(H,12,14) |
| InChIKey | NUFSYLNFXSNJQI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|