C15H18N4OS — CID 116667453
4-amino-N-phenyl-2-piperidin-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 116667453) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-amino-N-phenyl-2-piperidin-1-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-phenyl-2-piperidin-1-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116667453 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-amino-N-phenyl-2-piperidin-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | Nc1nc(N2CCCCC2)sc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H18N4OS/c16-13-12(14(20)17-11-7-3-1-4-8-11)21-15(18-13)19-9-5-2-6-10-19/h1,3-4,7-8H,2,5-6,9-10,16H2,(H,17,20) |
| InChIKey | RPRKBRYYJIUVHF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |