C18H17N3OS — CID 39071376
2-amino-N-(4-ethylphenyl)-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 39071376) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-amino-N-(4-ethylphenyl)-4-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(4-ethylphenyl)-4-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39071376 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-amino-N-(4-ethylphenyl)-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2sc(N)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N3OS/c1-2-12-8-10-14(11-9-12)20-17(22)16-15(21-18(19)23-16)13-6-4-3-5-7-13/h3-11H,2H2,1H3,(H2,19,21)(H,20,22) |
| InChIKey | OIXDWKHETKGKRY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |