C21H17N5O3S2 — CID 39115626
2-amino-4-phenyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 39115626) has the molecular formula C21H17N5O3S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-amino-4-phenyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-4-phenyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39115626 |
| Molecular Formula | C21H17N5O3S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 2-amino-4-phenyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | Nc1nc(-c2ccccc2)c(C(=O)Nc2ccc(S(=O)(=O)Nc3ccccn3)cc2)s1 |
| InChI | InChI=1S/C21H17N5O3S2/c22-21-25-18(14-6-2-1-3-7-14)19(30-21)20(27)24-15-9-11-16(12-10-15)31(28,29)26-17-8-4-5-13-23-17/h1-13H,(H2,22,25)(H,23,26)(H,24,27) |
| InChIKey | GYGAIRZXFHNFED-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |