C18H15N3O2S — CID 39071356
N-(4-acetylphenyl)-2-amino-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 39071356) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-amino-4-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-acetylphenyl)-2-amino-4-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39071356 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(4-acetylphenyl)-2-amino-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2sc(N)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N3O2S/c1-11(22)12-7-9-14(10-8-12)20-17(23)16-15(21-18(19)24-16)13-5-3-2-4-6-13/h2-10H,1H3,(H2,19,21)(H,20,23) |
| InChIKey | SXDADZOKJIPNRT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |