C17H14N4O4S — CID 39115643
2-amino-N-(4-methoxy-3-nitrophenyl)-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 39115643) has the molecular formula C17H14N4O4S and a molecular weight of 370.39 g/mol. Its IUPAC name is 2-amino-N-(4-methoxy-3-nitrophenyl)-4-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(4-methoxy-3-nitrophenyl)-4-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39115643 |
| Molecular Formula | C17H14N4O4S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-amino-N-(4-methoxy-3-nitrophenyl)-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2sc(N)nc2-c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N4O4S/c1-25-13-8-7-11(9-12(13)21(23)24)19-16(22)15-14(20-17(18)26-15)10-5-3-2-4-6-10/h2-9H,1H3,(H2,18,20)(H,19,22) |
| InChIKey | PFKQGNDPGICKIU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|