C23H18N4O4S — CID 3919463
2-anilino-N-(4-methoxyphenyl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 3919463) has the molecular formula C23H18N4O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is 2-anilino-N-(4-methoxyphenyl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-anilino-N-(4-methoxyphenyl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 3919463 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-anilino-N-(4-methoxyphenyl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2sc(Nc3ccccc3)nc2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H18N4O4S/c1-31-19-13-9-17(10-14-19)24-22(28)21-20(15-7-11-18(12-8-15)27(29)30)26-23(32-21)25-16-5-3-2-4-6-16/h2-14H,1H3,(H,24,28)(H,25,26) |
| InChIKey | NVUKHDUGYHKGKG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|