C21H17N4OS+ — CID 5049525
2-anilino-4-phenyl-N-pyridin-1-ium-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 5049525) has the molecular formula C21H17N4OS+ and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-anilino-4-phenyl-N-pyridin-1-ium-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-anilino-4-phenyl-N-pyridin-1-ium-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 5049525 |
| Molecular Formula | C21H17N4OS+ |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-anilino-4-phenyl-N-pyridin-1-ium-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc[nH+]c1)c1sc(Nc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H16N4OS/c26-20(23-17-12-7-13-22-14-17)19-18(15-8-3-1-4-9-15)25-21(27-19)24-16-10-5-2-6-11-16/h1-14H,(H,23,26)(H,24,25)/p+1 |
| InChIKey | DKLQPJVTAQCXQU-UHFFFAOYSA-O |
| XLogP | 4.62 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |