C19H19N3OS — CID 39071372
2-amino-4-phenyl-N-(4-propan-2-ylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 39071372) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-amino-4-phenyl-N-(4-propan-2-ylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-4-phenyl-N-(4-propan-2-ylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39071372 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-amino-4-phenyl-N-(4-propan-2-ylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)c2sc(N)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N3OS/c1-12(2)13-8-10-15(11-9-13)21-18(23)17-16(22-19(20)24-17)14-6-4-3-5-7-14/h3-12H,1-2H3,(H2,20,22)(H,21,23) |
| InChIKey | SUCJXNVOMOEPJK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |