C33H29N3O2S — CID 74017665
3-amino-5-methyl-6-phenyl-N-[4-[3-(4-propan-2-ylphenyl)prop-2-enoyl]phenyl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 74017665) has the molecular formula C33H29N3O2S and a molecular weight of 531.68 g/mol. Its IUPAC name is 3-amino-5-methyl-6-phenyl-N-[4-[3-(4-propan-2-ylphenyl)prop-2-enoyl]phenyl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-5-methyl-6-phenyl-N-[4-[3-(4-propan-2-ylphenyl)prop-2-enoyl]phenyl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 74017665 |
| Molecular Formula | C33H29N3O2S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 3-amino-5-methyl-6-phenyl-N-[4-[3-(4-propan-2-ylphenyl)prop-2-enoyl]phenyl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc2c(N)c(C(=O)Nc3ccc(C(=O)C=Cc4ccc(C(C)C)cc4)cc3)sc2nc1-c1ccccc1 |
| InChI | InChI=1S/C33H29N3O2S/c1-20(2)23-12-9-22(10-13-23)11-18-28(37)24-14-16-26(17-15-24)35-32(38)31-29(34)27-19-21(3)30(36-33(27)39-31)25-7-5-4-6-8-25/h4-20H,34H2,1-3H3,(H,35,38) |
| InChIKey | NZMUGZRZFLXJMU-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|