C17H15N3O2S — CID 39194626
2-amino-N-(2-hydroxy-5-methylphenyl)-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 39194626) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-5-methylphenyl)-4-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(2-hydroxy-5-methylphenyl)-4-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39194626 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-amino-N-(2-hydroxy-5-methylphenyl)-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ccc(O)c(NC(=O)c2sc(N)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C17H15N3O2S/c1-10-7-8-13(21)12(9-10)19-16(22)15-14(20-17(18)23-15)11-5-3-2-4-6-11/h2-9,21H,1H3,(H2,18,20)(H,19,22) |
| InChIKey | VPUIYFYBVONZKP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|