C15H13N3O2S — CID 41316370
3-amino-N-(2-hydroxy-5-methylphenyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 41316370) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 3-amino-N-(2-hydroxy-5-methylphenyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(2-hydroxy-5-methylphenyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 41316370 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-amino-N-(2-hydroxy-5-methylphenyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc(O)c(NC(=O)c2sc3ncccc3c2N)c1 |
| InChI | InChI=1S/C15H13N3O2S/c1-8-4-5-11(19)10(7-8)18-14(20)13-12(16)9-3-2-6-17-15(9)21-13/h2-7,19H,16H2,1H3,(H,18,20) |
| InChIKey | RQAKJVKWBRUHAH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|