C21H23N3O4S2 — CID 24644751
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methyl-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 24644751) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methyl-4-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methyl-4-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24644751 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methyl-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)c2sc(C)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C21H23N3O4S2/c1-4-24(5-2)30(27,28)16-11-12-18(25)17(13-16)23-21(26)20-19(22-14(3)29-20)15-9-7-6-8-10-15/h6-13,25H,4-5H2,1-3H3,(H,23,26) |
| InChIKey | URRCRYMZOMDUJU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|