C19H24N2O4S — CID 35993068
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2,3-dimethylbenzamide (PubChem CID 35993068) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2,3-dimethylbenzamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 35993068 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2,3-dimethylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C19H24N2O4S/c1-5-21(6-2)26(24,25)15-10-11-18(22)17(12-15)20-19(23)16-9-7-8-13(3)14(16)4/h7-12,22H,5-6H2,1-4H3,(H,20,23) |
| InChIKey | KYXQYDWMLSXVDW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|