C21H23FN4O4S — CID 55531902
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 55531902) has the molecular formula C21H23FN4O4S and a molecular weight of 446.50 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55531902 |
| Molecular Formula | C21H23FN4O4S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)c2cnn(-c3ccccc3F)c2C)c1 |
| InChI | InChI=1S/C21H23FN4O4S/c1-4-25(5-2)31(29,30)15-10-11-20(27)18(12-15)24-21(28)16-13-23-26(14(16)3)19-9-7-6-8-17(19)22/h6-13,27H,4-5H2,1-3H3,(H,24,28) |
| InChIKey | ZCTLTVKOGAIXHI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|