C16H13FN4O2 — CID 134026230
1-(2-fluorophenyl)-N-(3-hydroxy-2-pyridinyl)-5-methylpyrazole-4-carboxamide (PubChem CID 134026230) has the molecular formula C16H13FN4O2 and a molecular weight of 312.30 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(3-hydroxy-2-pyridinyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-(3-hydroxy-2-pyridinyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134026230 |
| Molecular Formula | C16H13FN4O2 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(3-hydroxy-2-pyridinyl)-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ncccc2O)cnn1-c1ccccc1F |
| InChI | InChI=1S/C16H13FN4O2/c1-10-11(16(23)20-15-14(22)7-4-8-18-15)9-19-21(10)13-6-3-2-5-12(13)17/h2-9,22H,1H3,(H,18,20,23) |
| InChIKey | FLCCTNSTCCXADE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |