C25H21FN4O3 — CID 55902341
N-[3-(2-anilino-2-oxoethoxy)phenyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 55902341) has the molecular formula C25H21FN4O3 and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[3-(2-anilino-2-oxoethoxy)phenyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[3-(2-anilino-2-oxoethoxy)phenyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55902341 |
| Molecular Formula | C25H21FN4O3 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-[3-(2-anilino-2-oxoethoxy)phenyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(OCC(=O)Nc3ccccc3)c2)cnn1-c1ccccc1F |
| InChI | InChI=1S/C25H21FN4O3/c1-17-21(15-27-30(17)23-13-6-5-12-22(23)26)25(32)29-19-10-7-11-20(14-19)33-16-24(31)28-18-8-3-2-4-9-18/h2-15H,16H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | IIHUKOIHITZLDS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |