C19H15ClFN3O3 — CID 38239464
methyl 2-chloro-5-[[1-(2-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]benzoate (PubChem CID 38239464) has the molecular formula C19H15ClFN3O3 and a molecular weight of 387.80 g/mol. Its IUPAC name is methyl 2-chloro-5-[[1-(2-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[1-(2-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 38239464 |
| Molecular Formula | C19H15ClFN3O3 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | methyl 2-chloro-5-[[1-(2-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2cnn(-c3ccccc3F)c2C)ccc1Cl |
| InChI | InChI=1S/C19H15ClFN3O3/c1-11-14(10-22-24(11)17-6-4-3-5-16(17)21)18(25)23-12-7-8-15(20)13(9-12)19(26)27-2/h3-10H,1-2H3,(H,23,25) |
| InChIKey | XJSGDTDPJWMOIB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |