C29H24FN3O4 — CID 55902095
N-[3-(2-anilino-2-oxoethoxy)phenyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide (PubChem CID 55902095) has the molecular formula C29H24FN3O4 and a molecular weight of 497.53 g/mol. Its IUPAC name is N-[3-(2-anilino-2-oxoethoxy)phenyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide.
| Compound Name | N-[3-(2-anilino-2-oxoethoxy)phenyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 55902095 |
| Molecular Formula | C29H24FN3O4 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[3-(2-anilino-2-oxoethoxy)phenyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(OCC(=O)Nc3ccccc3)c2)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C29H24FN3O4/c1-19-14-15-20(16-26(19)33-29(36)24-12-5-6-13-25(24)30)28(35)32-22-10-7-11-23(17-22)37-18-27(34)31-21-8-3-2-4-9-21/h2-17H,18H2,1H3,(H,31,34)(H,32,35)(H,33,36) |
| InChIKey | MTZKFWOSJUDTGR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |