C29H25N3O4 — CID 55630453
3-benzamido-N-[2-[(3-methoxyphenyl)carbamoyl]phenyl]-4-methylbenzamide (PubChem CID 55630453) has the molecular formula C29H25N3O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is 3-benzamido-N-[2-[(3-methoxyphenyl)carbamoyl]phenyl]-4-methylbenzamide.
| Compound Name | 3-benzamido-N-[2-[(3-methoxyphenyl)carbamoyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55630453 |
| Molecular Formula | C29H25N3O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 3-benzamido-N-[2-[(3-methoxyphenyl)carbamoyl]phenyl]-4-methylbenzamide |
| SMILES | COc1cccc(NC(=O)c2ccccc2NC(=O)c2ccc(C)c(NC(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C29H25N3O4/c1-19-15-16-21(17-26(19)32-27(33)20-9-4-3-5-10-20)28(34)31-25-14-7-6-13-24(25)29(35)30-22-11-8-12-23(18-22)36-2/h3-18H,1-2H3,(H,30,35)(H,31,34)(H,32,33) |
| InChIKey | JCMLVSIZBXAATE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |