C21H21FN4O3 — CID 35819656
N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carbohydrazide (PubChem CID 35819656) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carbohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 35819656 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(2-fluorophenyl)-5-methylpyrazole-4-carbohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)c2cnn(-c3ccccc3F)c2C)c1 |
| InChI | InChI=1S/C21H21FN4O3/c1-13-8-9-14(2)19(10-13)29-12-20(27)24-25-21(28)16-11-23-26(15(16)3)18-7-5-4-6-17(18)22/h4-11H,12H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | JKMKUFISMLUZPG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|