C17H14F4N2O3 — CID 3442692
N'-[2-(2,5-dimethylphenoxy)acetyl]-2,3,4,5-tetrafluorobenzohydrazide (PubChem CID 3442692) has the molecular formula C17H14F4N2O3 and a molecular weight of 370.30 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]-2,3,4,5-tetrafluorobenzohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2,3,4,5-tetrafluorobenzohydrazide |
|---|---|
| PubChem CID | 3442692 |
| Molecular Formula | C17H14F4N2O3 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2,3,4,5-tetrafluorobenzohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)c2cc(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C17H14F4N2O3/c1-8-3-4-9(2)12(5-8)26-7-13(24)22-23-17(25)10-6-11(18)15(20)16(21)14(10)19/h3-6H,7H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | QVYXGWBTWQBWIZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|