C15H16N4O3 — CID 38009598
N'-[2-(2,5-dimethylphenoxy)acetyl]pyrazine-2-carbohydrazide (PubChem CID 38009598) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]pyrazine-2-carbohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 38009598 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]pyrazine-2-carbohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)c2cnccn2)c1 |
| InChI | InChI=1S/C15H16N4O3/c1-10-3-4-11(2)13(7-10)22-9-14(20)18-19-15(21)12-8-16-5-6-17-12/h3-8H,9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | ZZQGEMTYKWKFLD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|