C15H16FN3O3 — CID 75417905
2-[[1-(2-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 75417905) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is 2-[[1-(2-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[1-(2-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 75417905 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[[1-(2-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | Cc1c(C(=O)NC(C)(C)C(=O)O)cnn1-c1ccccc1F |
| InChI | InChI=1S/C15H16FN3O3/c1-9-10(13(20)18-15(2,3)14(21)22)8-17-19(9)12-7-5-4-6-11(12)16/h4-8H,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | VPADIHCOININOX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |