C18H17FN4O — CID 39561723
1-(2-fluorophenyl)-5-methyl-N-(2-pyridin-3-ylethyl)pyrazole-4-carboxamide (PubChem CID 39561723) has the molecular formula C18H17FN4O and a molecular weight of 324.36 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-5-methyl-N-(2-pyridin-3-ylethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-5-methyl-N-(2-pyridin-3-ylethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 39561723 |
| Molecular Formula | C18H17FN4O |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-(2-fluorophenyl)-5-methyl-N-(2-pyridin-3-ylethyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCc2cccnc2)cnn1-c1ccccc1F |
| InChI | InChI=1S/C18H17FN4O/c1-13-15(12-22-23(13)17-7-3-2-6-16(17)19)18(24)21-10-8-14-5-4-9-20-11-14/h2-7,9,11-12H,8,10H2,1H3,(H,21,24) |
| InChIKey | BAESNAGWMWERGD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |